C16H22F3NO4S — CID 18705875
[2-(dipropylamino)-6-hydroxy-2,3-dihydro-1H-inden-5-yl] trifluoromethanesulfonate (PubChem CID 18705875) has the molecular formula C16H22F3NO4S and a molecular weight of 381.42 g/mol. Its IUPAC name is [2-(dipropylamino)-6-hydroxy-2,3-dihydro-1H-inden-5-yl] trifluoromethanesulfonate.
| Compound Name | [2-(dipropylamino)-6-hydroxy-2,3-dihydro-1H-inden-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18705875 |
| Molecular Formula | C16H22F3NO4S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | [2-(dipropylamino)-6-hydroxy-2,3-dihydro-1H-inden-5-yl] trifluoromethanesulfonate |
| SMILES | CCCN(CCC)C1Cc2cc(O)c(OS(=O)(=O)C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C16H22F3NO4S/c1-3-5-20(6-4-2)13-7-11-9-14(21)15(10-12(11)8-13)24-25(22,23)16(17,18)19/h9-10,13,21H,3-8H2,1-2H3 |
| InChIKey | RRTHRFFJGGDJFZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|