C15H17F6NO6S2 — CID 162618151
[2-(propylamino)-6-(2,2,2-trifluoroethoxysulfinyloxy)-2,3-dihydro-1H-inden-5-yl] trifluoromethanesulfonate (PubChem CID 162618151) has the molecular formula C15H17F6NO6S2 and a molecular weight of 485.42 g/mol. Its IUPAC name is [2-(propylamino)-6-(2,2,2-trifluoroethoxysulfinyloxy)-2,3-dihydro-1H-inden-5-yl] trifluoromethanesulfonate.
| Compound Name | [2-(propylamino)-6-(2,2,2-trifluoroethoxysulfinyloxy)-2,3-dihydro-1H-inden-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162618151 |
| Molecular Formula | C15H17F6NO6S2 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | [2-(propylamino)-6-(2,2,2-trifluoroethoxysulfinyloxy)-2,3-dihydro-1H-inden-5-yl] trifluoromethanesulfonate |
| SMILES | CCCNC1Cc2cc(OS(=O)OCC(F)(F)F)c(OS(=O)(=O)C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C15H17F6NO6S2/c1-2-3-22-11-4-9-6-12(27-29(23)26-8-14(16,17)18)13(7-10(9)5-11)28-30(24,25)15(19,20)21/h6-7,11,22H,2-5,8H2,1H3 |
| InChIKey | JKRSQHXFIGEXJV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|