C13H13F3O4S — CID 144634302
(4,5-dimethyl-7-oxo-6,8-dihydro-5H-naphthalen-1-yl) trifluoromethanesulfonate (PubChem CID 144634302) has the molecular formula C13H13F3O4S and a molecular weight of 322.30 g/mol. Its IUPAC name is (4,5-dimethyl-7-oxo-6,8-dihydro-5H-naphthalen-1-yl) trifluoromethanesulfonate.
| Compound Name | (4,5-dimethyl-7-oxo-6,8-dihydro-5H-naphthalen-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 144634302 |
| Molecular Formula | C13H13F3O4S |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | (4,5-dimethyl-7-oxo-6,8-dihydro-5H-naphthalen-1-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)C(F)(F)F)c2c1C(C)CC(=O)C2 |
| InChI | InChI=1S/C13H13F3O4S/c1-7-3-4-11(20-21(18,19)13(14,15)16)10-6-9(17)5-8(2)12(7)10/h3-4,8H,5-6H2,1-2H3 |
| InChIKey | PLXLWBHOAPYCLI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|