C19H17F5O6S — CID 159850239
7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-4-ol;(7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-4-yl) trifluoromethanesulfonate (PubChem CID 159850239) has the molecular formula C19H17F5O6S and a molecular weight of 468.40 g/mol. Its IUPAC name is 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-4-ol;(7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-4-yl) trifluoromethanesulfonate.
| Compound Name | 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-4-ol;(7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159850239 |
| Molecular Formula | C19H17F5O6S |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-4-ol;(7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-4-yl) trifluoromethanesulfonate |
| SMILES | CC1Cc2c(O)ccc(F)c2O1.CC1Cc2c(OS(=O)(=O)C(F)(F)F)ccc(F)c2O1 |
| InChI | InChI=1S/C10H8F4O4S.C9H9FO2/c1-5-4-6-8(3-2-7(11)9(6)17-5)18-19(15,16)10(12,13)14;1-5-4-6-8(11)3-2-7(10)9(6)12-5/h2-3,5H,4H2,1H3;2-3,5,11H,4H2,1H3 |
| InChIKey | NPVKPIQRWVRXCE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|