C26H32N2O4 — CID 139959563
2-[5-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]pentyl]isoindole-1,3-dione (PubChem CID 139959563) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is 2-[5-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]pentyl]isoindole-1,3-dione.
| Compound Name | 2-[5-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139959563 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 2-[5-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]pentyl]isoindole-1,3-dione |
| SMILES | CCCN(CCCCCN1C(=O)c2ccccc2C1=O)C1COc2cccc(OC)c2C1 |
| InChI | InChI=1S/C26H32N2O4/c1-3-14-27(19-17-22-23(31-2)12-9-13-24(22)32-18-19)15-7-4-8-16-28-25(29)20-10-5-6-11-21(20)26(28)30/h5-6,9-13,19H,3-4,7-8,14-18H2,1-2H3 |
| InChIKey | YHESATLTPPXUNZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|