methyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate

C17H25NO3 — CID 19028093

IUPACmethyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate
SMILESCCCN(CCC)C1COc2cccc(C(=O)OC)c2C1
InChIInChI=1S/C17H25NO3/c1-4-9-18(10-5-2)13-11-15-14(17(19)20-3)7-6-8-16(15)21-12-13/h6-8,13H,4-5,9-12H2,1-3H3
InChIKeyIVLKGOWYAWHDBT-UHFFFAOYSA-N
MW291.39 g/mol
LogP2.90
Rot. Bonds6

About methyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate

methyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate (PubChem CID 19028093) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is methyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate.

Molecular Properties

Compound Namemethyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate
PubChem CID19028093
Molecular FormulaC17H25NO3
Molecular Weight291.39 g/mol
Exact Mass291.18
IUPAC Namemethyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate
SMILESCCCN(CCC)C1COc2cccc(C(=O)OC)c2C1
InChIInChI=1S/C17H25NO3/c1-4-9-18(10-5-2)13-11-15-14(17(19)20-3)7-6-8-16(15)21-12-13/h6-8,13H,4-5,9-12H2,1-3H3
InChIKeyIVLKGOWYAWHDBT-UHFFFAOYSA-N
XLogP2.90
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.39
LogP ≤ 52.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate?
The IUPAC name of methyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate (CID 19028093) is methyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate.
What is the SMILES notation for methyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate?
The canonical SMILES for methyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate is CCCN(CCC)C1COc2cccc(C(=O)OC)c2C1.
What is the InChIKey of methyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate?
The InChIKey is IVLKGOWYAWHDBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO3/c1-4-9-18(10-5-2)13-11-15-14(17(19)20-3)7-6-8-16(15)21-12-13/h6-8,13H,4-5,9-12H2,1-3H3.
What are the key properties of methyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate?
methyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate has a molecular weight of 291.39 g/mol, XLogP of 2.90, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(dipropylamino)-3,4-dihydro-2H-chromene-5-carboxylate is sourced from PubChem (CID 19028093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).