About methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-4-carboxylate
methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-4-carboxylate (PubChem CID 130722266) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-4-carboxylate.
Analyze methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-4-carboxylate?
The IUPAC name of methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-4-carboxylate (CID 130722266) is methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-4-carboxylate.
What is the SMILES notation for methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-4-carboxylate?
The canonical SMILES for methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-4-carboxylate is COC(=O)c1cccc2c1[C@H](N)CO2.
What is the InChIKey of methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-4-carboxylate?
The InChIKey is RPIKZDNLPCMRSG-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H11NO3/c1-13-10(12)6-3-2-4-8-9(6)7(11)5-14-8/h2-4,7H,5,11H2,1H3/t7-/m1/s1.
What are the key properties of methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-4-carboxylate?
methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-4-carboxylate has a molecular weight of 193.20 g/mol, XLogP of 0.87, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-4-carboxylate is sourced from PubChem (CID 130722266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).