C10H12Cl2FNO2 — CID 155712838
(3aS,9aS)-5-fluoro-2,3,3a,9a-tetrahydro-1H-[1,4]benzodioxino[2,3-c]pyrrole;dihydrochloride (PubChem CID 155712838) has the molecular formula C10H12Cl2FNO2 and a molecular weight of 268.12 g/mol. Its IUPAC name is (3aS,9aS)-5-fluoro-2,3,3a,9a-tetrahydro-1H-[1,4]benzodioxino[2,3-c]pyrrole;dihydrochloride.
| Compound Name | (3aS,9aS)-5-fluoro-2,3,3a,9a-tetrahydro-1H-[1,4]benzodioxino[2,3-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 155712838 |
| Molecular Formula | C10H12Cl2FNO2 |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | (3aS,9aS)-5-fluoro-2,3,3a,9a-tetrahydro-1H-[1,4]benzodioxino[2,3-c]pyrrole;dihydrochloride |
| SMILES | Cl.Cl.Fc1cccc2c1O[C@H]1CNC[C@@H]1O2 |
| InChI | InChI=1S/C10H10FNO2.2ClH/c11-6-2-1-3-7-10(6)14-9-5-12-4-8(9)13-7;;/h1-3,8-9,12H,4-5H2;2*1H/t8-,9-;;/m0../s1 |
| InChIKey | OUKFZRQBWYXDAJ-CDEWPDHBSA-N |
| XLogP | 1.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |