C8H4N2O3 — CID 22060417
2-nitro-7-oxabicyclo[4.2.0]octa-1,3,5-triene-8-carbonitrile (PubChem CID 22060417) has the molecular formula C8H4N2O3 and a molecular weight of 176.13 g/mol. Its IUPAC name is 2-nitro-7-oxabicyclo[4.2.0]octa-1,3,5-triene-8-carbonitrile.
| Compound Name | 2-nitro-7-oxabicyclo[4.2.0]octa-1,3,5-triene-8-carbonitrile |
|---|---|
| PubChem CID | 22060417 |
| Molecular Formula | C8H4N2O3 |
| Molecular Weight | 176.13 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | 2-nitro-7-oxabicyclo[4.2.0]octa-1,3,5-triene-8-carbonitrile |
| SMILES | N#CC1Oc2cccc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C8H4N2O3/c9-4-7-8-5(10(11)12)2-1-3-6(8)13-7/h1-3,7H |
| InChIKey | HXSGAQLOQGTNMI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.13 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|