C12H12N3O6P — CID 177392239
2-amino-4-dimethoxyphosphoryl-5-nitro-4H-chromene-3-carbonitrile (PubChem CID 177392239) has the molecular formula C12H12N3O6P and a molecular weight of 325.22 g/mol. Its IUPAC name is 2-amino-4-dimethoxyphosphoryl-5-nitro-4H-chromene-3-carbonitrile.
| Compound Name | 2-amino-4-dimethoxyphosphoryl-5-nitro-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 177392239 |
| Molecular Formula | C12H12N3O6P |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-amino-4-dimethoxyphosphoryl-5-nitro-4H-chromene-3-carbonitrile |
| SMILES | COP(=O)(OC)C1C(C#N)=C(N)Oc2cccc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C12H12N3O6P/c1-19-22(18,20-2)11-7(6-13)12(14)21-9-5-3-4-8(10(9)11)15(16)17/h3-5,11H,14H2,1-2H3 |
| InChIKey | RCANHXJGYICFST-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|