C20H14ClN5O3 — CID 1289656
(4S)-6-amino-4-(2-chloro-6-nitrophenyl)-3-methyl-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 1289656) has the molecular formula C20H14ClN5O3 and a molecular weight of 407.82 g/mol. Its IUPAC name is (4S)-6-amino-4-(2-chloro-6-nitrophenyl)-3-methyl-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | (4S)-6-amino-4-(2-chloro-6-nitrophenyl)-3-methyl-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 1289656 |
| Molecular Formula | C20H14ClN5O3 |
| Molecular Weight | 407.82 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (4S)-6-amino-4-(2-chloro-6-nitrophenyl)-3-methyl-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | Cc1nn(-c2ccccc2)c2c1[C@H](c1c(Cl)cccc1[N+](=O)[O-])C(C#N)=C(N)O2 |
| InChI | InChI=1S/C20H14ClN5O3/c1-11-16-17(18-14(21)8-5-9-15(18)26(27)28)13(10-22)19(23)29-20(16)25(24-11)12-6-3-2-4-7-12/h2-9,17H,23H2,1H3/t17-/m1/s1 |
| InChIKey | VUGNTQIOXCQVAV-QGZVFWFLSA-N |
| XLogP | 3.96 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.82 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|