C19H15N5O — CID 679346
(4R)-6-amino-3-methyl-1-phenyl-4-pyridin-2-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 679346) has the molecular formula C19H15N5O and a molecular weight of 329.36 g/mol. Its IUPAC name is (4R)-6-amino-3-methyl-1-phenyl-4-pyridin-2-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | (4R)-6-amino-3-methyl-1-phenyl-4-pyridin-2-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 679346 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (4R)-6-amino-3-methyl-1-phenyl-4-pyridin-2-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | Cc1nn(-c2ccccc2)c2c1[C@@H](c1ccccn1)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C19H15N5O/c1-12-16-17(15-9-5-6-10-22-15)14(11-20)18(21)25-19(16)24(23-12)13-7-3-2-4-8-13/h2-10,17H,21H2,1H3/t17-/m1/s1 |
| InChIKey | UTNLZACHEUVEQA-QGZVFWFLSA-N |
| XLogP | 2.79 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|