C23H17N5O — CID 3154849
6-amino-3-methyl-1-phenyl-4-quinolin-4-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 3154849) has the molecular formula C23H17N5O and a molecular weight of 379.42 g/mol. Its IUPAC name is 6-amino-3-methyl-1-phenyl-4-quinolin-4-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-3-methyl-1-phenyl-4-quinolin-4-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 3154849 |
| Molecular Formula | C23H17N5O |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 6-amino-3-methyl-1-phenyl-4-quinolin-4-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1ccnc3ccccc13)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C23H17N5O/c1-14-20-21(17-11-12-26-19-10-6-5-9-16(17)19)18(13-24)22(25)29-23(20)28(27-14)15-7-3-2-4-8-15/h2-12,21H,25H2,1H3 |
| InChIKey | SZPJLTNZFZFIRL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|