C24H18N4O — CID 2839102
6-amino-3-methyl-4-naphthalen-1-yl-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 2839102) has the molecular formula C24H18N4O and a molecular weight of 378.44 g/mol. Its IUPAC name is 6-amino-3-methyl-4-naphthalen-1-yl-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-3-methyl-4-naphthalen-1-yl-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 2839102 |
| Molecular Formula | C24H18N4O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 6-amino-3-methyl-4-naphthalen-1-yl-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1cccc3ccccc13)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C24H18N4O/c1-15-21-22(19-13-7-9-16-8-5-6-12-18(16)19)20(14-25)23(26)29-24(21)28(27-15)17-10-3-2-4-11-17/h2-13,22H,26H2,1H3 |
| InChIKey | CWWVGVGLPUUAQD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|