C22H19BrN4O2 — CID 1041826
(4S)-6-amino-4-(5-bromo-2-ethoxyphenyl)-3-methyl-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 1041826) has the molecular formula C22H19BrN4O2 and a molecular weight of 451.32 g/mol. Its IUPAC name is (4S)-6-amino-4-(5-bromo-2-ethoxyphenyl)-3-methyl-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | (4S)-6-amino-4-(5-bromo-2-ethoxyphenyl)-3-methyl-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 1041826 |
| Molecular Formula | C22H19BrN4O2 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | (4S)-6-amino-4-(5-bromo-2-ethoxyphenyl)-3-methyl-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | CCOc1ccc(Br)cc1[C@@H]1C(C#N)=C(N)Oc2c1c(C)nn2-c1ccccc1 |
| InChI | InChI=1S/C22H19BrN4O2/c1-3-28-18-10-9-14(23)11-16(18)20-17(12-24)21(25)29-22-19(20)13(2)26-27(22)15-7-5-4-6-8-15/h4-11,20H,3,25H2,1-2H3/t20-/m1/s1 |
| InChIKey | PQVUSVXUGQCLFW-HXUWFJFHSA-N |
| XLogP | 4.56 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|