C25H23ClN4O5 — CID 1314330
methyl 2-[4-[(4R)-6-amino-5-cyano-3-methyl-1-phenyl-4H-pyrano[3,2-d]pyrazol-4-yl]-5-chloro-2-ethoxyphenoxy]acetate (PubChem CID 1314330) has the molecular formula C25H23ClN4O5 and a molecular weight of 494.94 g/mol. Its IUPAC name is methyl 2-[4-[(4R)-6-amino-5-cyano-3-methyl-1-phenyl-4H-pyrano[3,2-d]pyrazol-4-yl]-5-chloro-2-ethoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(4R)-6-amino-5-cyano-3-methyl-1-phenyl-4H-pyrano[3,2-d]pyrazol-4-yl]-5-chloro-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 1314330 |
| Molecular Formula | C25H23ClN4O5 |
| Molecular Weight | 494.94 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | methyl 2-[4-[(4R)-6-amino-5-cyano-3-methyl-1-phenyl-4H-pyrano[3,2-d]pyrazol-4-yl]-5-chloro-2-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc([C@H]2C(C#N)=C(N)Oc3c2c(C)nn3-c2ccccc2)c(Cl)cc1OCC(=O)OC |
| InChI | InChI=1S/C25H23ClN4O5/c1-4-33-19-10-16(18(26)11-20(19)34-13-21(31)32-3)23-17(12-27)24(28)35-25-22(23)14(2)29-30(25)15-8-6-5-7-9-15/h5-11,23H,4,13,28H2,1-3H3/t23-/m0/s1 |
| InChIKey | AKCHAGQLBIHYPU-QHCPKHFHSA-N |
| XLogP | 4.00 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.94 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|