C23H20ClN5O4 — CID 5211274
2-[4-[6-amino-1-(3-chlorophenyl)-5-cyano-3-methyl-4H-pyrano[3,2-d]pyrazol-4-yl]-2-methoxyphenoxy]acetamide (PubChem CID 5211274) has the molecular formula C23H20ClN5O4 and a molecular weight of 465.90 g/mol. Its IUPAC name is 2-[4-[6-amino-1-(3-chlorophenyl)-5-cyano-3-methyl-4H-pyrano[3,2-d]pyrazol-4-yl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[6-amino-1-(3-chlorophenyl)-5-cyano-3-methyl-4H-pyrano[3,2-d]pyrazol-4-yl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 5211274 |
| Molecular Formula | C23H20ClN5O4 |
| Molecular Weight | 465.90 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-[4-[6-amino-1-(3-chlorophenyl)-5-cyano-3-methyl-4H-pyrano[3,2-d]pyrazol-4-yl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3c2c(C)nn3-c2cccc(Cl)c2)ccc1OCC(N)=O |
| InChI | InChI=1S/C23H20ClN5O4/c1-12-20-21(13-6-7-17(18(8-13)31-2)32-11-19(26)30)16(10-25)22(27)33-23(20)29(28-12)15-5-3-4-14(24)9-15/h3-9,21H,11,27H2,1-2H3,(H2,26,30) |
| InChIKey | UMVKJVYYIQOZRS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 138.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.90 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|