C24H23N5O4 — CID 19616860
2-[4-[6-amino-5-cyano-3-methyl-1-(3-methylphenyl)-4H-pyrano[3,2-d]pyrazol-4-yl]-2-methoxyphenoxy]acetamide (PubChem CID 19616860) has the molecular formula C24H23N5O4 and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-[4-[6-amino-5-cyano-3-methyl-1-(3-methylphenyl)-4H-pyrano[3,2-d]pyrazol-4-yl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[6-amino-5-cyano-3-methyl-1-(3-methylphenyl)-4H-pyrano[3,2-d]pyrazol-4-yl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 19616860 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 2-[4-[6-amino-5-cyano-3-methyl-1-(3-methylphenyl)-4H-pyrano[3,2-d]pyrazol-4-yl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3c2c(C)nn3-c2cccc(C)c2)ccc1OCC(N)=O |
| InChI | InChI=1S/C24H23N5O4/c1-13-5-4-6-16(9-13)29-24-21(14(2)28-29)22(17(11-25)23(27)33-24)15-7-8-18(19(10-15)31-3)32-12-20(26)30/h4-10,22H,12,27H2,1-3H3,(H2,26,30) |
| InChIKey | QRLCMPDIXDFNFY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 138.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|