C21H16N4O3 — CID 50888133
3-(6-amino-5-cyano-3-methyl-4-phenyl-4H-pyrano[3,2-d]pyrazol-1-yl)benzoic acid (PubChem CID 50888133) has the molecular formula C21H16N4O3 and a molecular weight of 372.38 g/mol. Its IUPAC name is 3-(6-amino-5-cyano-3-methyl-4-phenyl-4H-pyrano[3,2-d]pyrazol-1-yl)benzoic acid.
| Compound Name | 3-(6-amino-5-cyano-3-methyl-4-phenyl-4H-pyrano[3,2-d]pyrazol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 50888133 |
| Molecular Formula | C21H16N4O3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 3-(6-amino-5-cyano-3-methyl-4-phenyl-4H-pyrano[3,2-d]pyrazol-1-yl)benzoic acid |
| SMILES | Cc1nn(-c2cccc(C(=O)O)c2)c2c1C(c1ccccc1)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C21H16N4O3/c1-12-17-18(13-6-3-2-4-7-13)16(11-22)19(23)28-20(17)25(24-12)15-9-5-8-14(10-15)21(26)27/h2-10,18H,23H2,1H3,(H,26,27) |
| InChIKey | YMKSLRVFYJVMSD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|