C27H20N4O6 — CID 50888118
3-[6-amino-5-cyano-4-[5-(3-methoxycarbonylphenyl)furan-2-yl]-3-methyl-4H-pyrano[3,2-d]pyrazol-1-yl]benzoic acid (PubChem CID 50888118) has the molecular formula C27H20N4O6 and a molecular weight of 496.48 g/mol. Its IUPAC name is 3-[6-amino-5-cyano-4-[5-(3-methoxycarbonylphenyl)furan-2-yl]-3-methyl-4H-pyrano[3,2-d]pyrazol-1-yl]benzoic acid.
| Compound Name | 3-[6-amino-5-cyano-4-[5-(3-methoxycarbonylphenyl)furan-2-yl]-3-methyl-4H-pyrano[3,2-d]pyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50888118 |
| Molecular Formula | C27H20N4O6 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 3-[6-amino-5-cyano-4-[5-(3-methoxycarbonylphenyl)furan-2-yl]-3-methyl-4H-pyrano[3,2-d]pyrazol-1-yl]benzoic acid |
| SMILES | COC(=O)c1cccc(-c2ccc(C3C(C#N)=C(N)Oc4c3c(C)nn4-c3cccc(C(=O)O)c3)o2)c1 |
| InChI | InChI=1S/C27H20N4O6/c1-14-22-23(21-10-9-20(36-21)15-5-3-7-17(11-15)27(34)35-2)19(13-28)24(29)37-25(22)31(30-14)18-8-4-6-16(12-18)26(32)33/h3-12,23H,29H2,1-2H3,(H,32,33) |
| InChIKey | RESABISQUYRVQH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 153.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|