C25H16Cl2N4O4 — CID 50888184
3-[6-amino-5-cyano-4-[5-(2,3-dichlorophenyl)furan-2-yl]-3-methyl-4H-pyrano[3,2-d]pyrazol-1-yl]benzoic acid (PubChem CID 50888184) has the molecular formula C25H16Cl2N4O4 and a molecular weight of 507.33 g/mol. Its IUPAC name is 3-[6-amino-5-cyano-4-[5-(2,3-dichlorophenyl)furan-2-yl]-3-methyl-4H-pyrano[3,2-d]pyrazol-1-yl]benzoic acid.
| Compound Name | 3-[6-amino-5-cyano-4-[5-(2,3-dichlorophenyl)furan-2-yl]-3-methyl-4H-pyrano[3,2-d]pyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50888184 |
| Molecular Formula | C25H16Cl2N4O4 |
| Molecular Weight | 507.33 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | 3-[6-amino-5-cyano-4-[5-(2,3-dichlorophenyl)furan-2-yl]-3-methyl-4H-pyrano[3,2-d]pyrazol-1-yl]benzoic acid |
| SMILES | Cc1nn(-c2cccc(C(=O)O)c2)c2c1C(c1ccc(-c3cccc(Cl)c3Cl)o1)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C25H16Cl2N4O4/c1-12-20-21(19-9-8-18(34-19)15-6-3-7-17(26)22(15)27)16(11-28)23(29)35-24(20)31(30-12)14-5-2-4-13(10-14)25(32)33/h2-10,21H,29H2,1H3,(H,32,33) |
| InChIKey | LOUJGOJWYSVQSI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 127.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.33 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|