C25H21N5O5 — CID 50888777
3-[6-amino-5-cyano-4-[4-(cyanomethoxy)-3-ethoxyphenyl]-3-methyl-4H-pyrano[3,2-d]pyrazol-1-yl]benzoic acid (PubChem CID 50888777) has the molecular formula C25H21N5O5 and a molecular weight of 471.47 g/mol. Its IUPAC name is 3-[6-amino-5-cyano-4-[4-(cyanomethoxy)-3-ethoxyphenyl]-3-methyl-4H-pyrano[3,2-d]pyrazol-1-yl]benzoic acid.
| Compound Name | 3-[6-amino-5-cyano-4-[4-(cyanomethoxy)-3-ethoxyphenyl]-3-methyl-4H-pyrano[3,2-d]pyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50888777 |
| Molecular Formula | C25H21N5O5 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 3-[6-amino-5-cyano-4-[4-(cyanomethoxy)-3-ethoxyphenyl]-3-methyl-4H-pyrano[3,2-d]pyrazol-1-yl]benzoic acid |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3c2c(C)nn3-c2cccc(C(=O)O)c2)ccc1OCC#N |
| InChI | InChI=1S/C25H21N5O5/c1-3-33-20-12-15(7-8-19(20)34-10-9-26)22-18(13-27)23(28)35-24-21(22)14(2)29-30(24)17-6-4-5-16(11-17)25(31)32/h4-8,11-12,22H,3,10,28H2,1-2H3,(H,31,32) |
| InChIKey | WUVITLDSUZLWAL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|