C25H19N3O7 — CID 19123055
[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-4H-chromen-7-yl] 2-nitrobenzoate (PubChem CID 19123055) has the molecular formula C25H19N3O7 and a molecular weight of 473.44 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-4H-chromen-7-yl] 2-nitrobenzoate.
| Compound Name | [2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-4H-chromen-7-yl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 19123055 |
| Molecular Formula | C25H19N3O7 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | [2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-4H-chromen-7-yl] 2-nitrobenzoate |
| SMILES | COc1ccc(OC)c(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccccc4[N+](=O)[O-])ccc32)c1 |
| InChI | InChI=1S/C25H19N3O7/c1-32-14-8-10-21(33-2)18(11-14)23-17-9-7-15(12-22(17)35-24(27)19(23)13-26)34-25(29)16-5-3-4-6-20(16)28(30)31/h3-12,23H,27H2,1-2H3 |
| InChIKey | BQSZINOMAUGJNU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|