C32H23Cl2N3O7 — CID 19127851
[2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 2-nitrobenzoate (PubChem CID 19127851) has the molecular formula C32H23Cl2N3O7 and a molecular weight of 632.46 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 2-nitrobenzoate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 19127851 |
| Molecular Formula | C32H23Cl2N3O7 |
| Molecular Weight | 632.46 g/mol |
| Exact Mass | 631.09 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 2-nitrobenzoate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccccc4[N+](=O)[O-])ccc32)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C32H23Cl2N3O7/c1-2-41-29-13-18(8-12-27(29)42-17-19-7-9-20(33)14-25(19)34)30-23-11-10-21(15-28(23)44-31(36)24(30)16-35)43-32(38)22-5-3-4-6-26(22)37(39)40/h3-15,30H,2,17,36H2,1H3 |
| InChIKey | BEAPCEUCXZAMSI-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.46 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|