C32H22Cl4N2O5 — CID 19127844
[2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 2,4-dichlorobenzoate (PubChem CID 19127844) has the molecular formula C32H22Cl4N2O5 and a molecular weight of 656.35 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 2,4-dichlorobenzoate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 19127844 |
| Molecular Formula | C32H22Cl4N2O5 |
| Molecular Weight | 656.35 g/mol |
| Exact Mass | 654.03 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 2,4-dichlorobenzoate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccc(Cl)cc4Cl)ccc32)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C32H22Cl4N2O5/c1-2-40-29-11-17(4-10-27(29)41-16-18-3-5-19(33)12-25(18)35)30-23-9-7-21(14-28(23)43-31(38)24(30)15-37)42-32(39)22-8-6-20(34)13-26(22)36/h3-14,30H,2,16,38H2,1H3 |
| InChIKey | SOIMZWPNZXVSKS-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.35 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|