C25H18Cl2N2O3 — CID 19123688
[2-amino-3-cyano-4-(4-ethylphenyl)-4H-chromen-7-yl] 2,4-dichlorobenzoate (PubChem CID 19123688) has the molecular formula C25H18Cl2N2O3 and a molecular weight of 465.34 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-ethylphenyl)-4H-chromen-7-yl] 2,4-dichlorobenzoate.
| Compound Name | [2-amino-3-cyano-4-(4-ethylphenyl)-4H-chromen-7-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 19123688 |
| Molecular Formula | C25H18Cl2N2O3 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | [2-amino-3-cyano-4-(4-ethylphenyl)-4H-chromen-7-yl] 2,4-dichlorobenzoate |
| SMILES | CCc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccc(Cl)cc4Cl)ccc32)cc1 |
| InChI | InChI=1S/C25H18Cl2N2O3/c1-2-14-3-5-15(6-4-14)23-19-10-8-17(12-22(19)32-24(29)20(23)13-28)31-25(30)18-9-7-16(26)11-21(18)27/h3-12,23H,2,29H2,1H3 |
| InChIKey | BJVUJVKUHDIQLB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|