C25H19ClN2O3 — CID 19123723
[2-amino-3-cyano-4-(4-ethylphenyl)-4H-chromen-7-yl] 3-chlorobenzoate (PubChem CID 19123723) has the molecular formula C25H19ClN2O3 and a molecular weight of 430.89 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-ethylphenyl)-4H-chromen-7-yl] 3-chlorobenzoate.
| Compound Name | [2-amino-3-cyano-4-(4-ethylphenyl)-4H-chromen-7-yl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 19123723 |
| Molecular Formula | C25H19ClN2O3 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | [2-amino-3-cyano-4-(4-ethylphenyl)-4H-chromen-7-yl] 3-chlorobenzoate |
| SMILES | CCc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cccc(Cl)c4)ccc32)cc1 |
| InChI | InChI=1S/C25H19ClN2O3/c1-2-15-6-8-16(9-7-15)23-20-11-10-19(13-22(20)31-24(28)21(23)14-27)30-25(29)17-4-3-5-18(26)12-17/h3-13,23H,2,28H2,1H3 |
| InChIKey | YRBZYMREMKGLBW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|