C29H27ClN2O5 — CID 19123403
[2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 3-chlorobenzoate (PubChem CID 19123403) has the molecular formula C29H27ClN2O5 and a molecular weight of 519.00 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 3-chlorobenzoate.
| Compound Name | [2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 19123403 |
| Molecular Formula | C29H27ClN2O5 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | [2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 3-chlorobenzoate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cccc(Cl)c4)ccc32)ccc1OCCC(C)C |
| InChI | InChI=1S/C29H27ClN2O5/c1-17(2)11-12-35-24-10-7-18(14-26(24)34-3)27-22-9-8-21(15-25(22)37-28(32)23(27)16-31)36-29(33)19-5-4-6-20(30)13-19/h4-10,13-15,17,27H,11-12,32H2,1-3H3 |
| InChIKey | SFXKNKCAMJSMCN-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|