C30H29BrN2O5 — CID 19124950
[2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-bromobenzoate (PubChem CID 19124950) has the molecular formula C30H29BrN2O5 and a molecular weight of 577.48 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-bromobenzoate.
| Compound Name | [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 19124950 |
| Molecular Formula | C30H29BrN2O5 |
| Molecular Weight | 577.48 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-bromobenzoate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccc(Br)cc4)ccc32)ccc1OCCC(C)C |
| InChI | InChI=1S/C30H29BrN2O5/c1-4-35-27-15-20(7-12-25(27)36-14-13-18(2)3)28-23-11-10-22(16-26(23)38-29(33)24(28)17-32)37-30(34)19-5-8-21(31)9-6-19/h5-12,15-16,18,28H,4,13-14,33H2,1-3H3 |
| InChIKey | NFKBAOAGRJJSBB-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.48 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|