C33H30N2O7 — CID 19129209
[2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 2-oxochromene-3-carboxylate (PubChem CID 19129209) has the molecular formula C33H30N2O7 and a molecular weight of 566.61 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 19129209 |
| Molecular Formula | C33H30N2O7 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 2-oxochromene-3-carboxylate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cc5ccccc5oc4=O)ccc32)ccc1OCCC(C)C |
| InChI | InChI=1S/C33H30N2O7/c1-4-38-29-16-21(9-12-27(29)39-14-13-19(2)3)30-23-11-10-22(17-28(23)41-31(35)25(30)18-34)40-32(36)24-15-20-7-5-6-8-26(20)42-33(24)37/h5-12,15-17,19,30H,4,13-14,35H2,1-3H3 |
| InChIKey | ABDJUHZLGWVGBM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|