C28H28N2O6 — CID 19124969
[2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] furan-2-carboxylate (PubChem CID 19124969) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] furan-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 19124969 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] furan-2-carboxylate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccco4)ccc32)ccc1OCCC(C)C |
| InChI | InChI=1S/C28H28N2O6/c1-4-32-25-14-18(7-10-22(25)34-13-11-17(2)3)26-20-9-8-19(35-28(31)23-6-5-12-33-23)15-24(20)36-27(30)21(26)16-29/h5-10,12,14-15,17,26H,4,11,13,30H2,1-3H3 |
| InChIKey | PGGGQQUYGAQTOA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|