C31H26N2O6 — CID 19127446
[2-amino-3-cyano-4-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] furan-2-carboxylate (PubChem CID 19127446) has the molecular formula C31H26N2O6 and a molecular weight of 522.56 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] furan-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 19127446 |
| Molecular Formula | C31H26N2O6 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | [2-amino-3-cyano-4-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] furan-2-carboxylate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccco4)ccc32)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C31H26N2O6/c1-3-35-28-15-21(10-13-25(28)37-18-20-8-6-19(2)7-9-20)29-23-12-11-22(38-31(34)26-5-4-14-36-26)16-27(23)39-30(33)24(29)17-32/h4-16,29H,3,18,33H2,1-2H3 |
| InChIKey | OBWYIDZLSRMDDI-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|