C23H18N2O5 — CID 19125687
[2-amino-3-cyano-4-(4-ethoxyphenyl)-4H-chromen-7-yl] furan-2-carboxylate (PubChem CID 19125687) has the molecular formula C23H18N2O5 and a molecular weight of 402.41 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-ethoxyphenyl)-4H-chromen-7-yl] furan-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(4-ethoxyphenyl)-4H-chromen-7-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 19125687 |
| Molecular Formula | C23H18N2O5 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [2-amino-3-cyano-4-(4-ethoxyphenyl)-4H-chromen-7-yl] furan-2-carboxylate |
| SMILES | CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccco4)ccc32)cc1 |
| InChI | InChI=1S/C23H18N2O5/c1-2-27-15-7-5-14(6-8-15)21-17-10-9-16(29-23(26)19-4-3-11-28-19)12-20(17)30-22(25)18(21)13-24/h3-12,21H,2,25H2,1H3 |
| InChIKey | RSTUJXZEWYUHPD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|