C27H22N2O6 — CID 19124570
methyl 4-[2-amino-3-cyano-7-(4-ethoxybenzoyl)oxy-4H-chromen-4-yl]benzoate (PubChem CID 19124570) has the molecular formula C27H22N2O6 and a molecular weight of 470.48 g/mol. Its IUPAC name is methyl 4-[2-amino-3-cyano-7-(4-ethoxybenzoyl)oxy-4H-chromen-4-yl]benzoate.
| Compound Name | methyl 4-[2-amino-3-cyano-7-(4-ethoxybenzoyl)oxy-4H-chromen-4-yl]benzoate |
|---|---|
| PubChem CID | 19124570 |
| Molecular Formula | C27H22N2O6 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | methyl 4-[2-amino-3-cyano-7-(4-ethoxybenzoyl)oxy-4H-chromen-4-yl]benzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C27H22N2O6/c1-3-33-19-10-8-18(9-11-19)27(31)34-20-12-13-21-23(14-20)35-25(29)22(15-28)24(21)16-4-6-17(7-5-16)26(30)32-2/h4-14,24H,3,29H2,1-2H3 |
| InChIKey | CWDAZZUGFJIDNX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 120.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|