C29H26N2O6 — CID 19124609
[2-amino-3-cyano-4-(4-methoxycarbonylphenyl)-4H-chromen-7-yl] 2-butoxybenzoate (PubChem CID 19124609) has the molecular formula C29H26N2O6 and a molecular weight of 498.54 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-methoxycarbonylphenyl)-4H-chromen-7-yl] 2-butoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-(4-methoxycarbonylphenyl)-4H-chromen-7-yl] 2-butoxybenzoate |
|---|---|
| PubChem CID | 19124609 |
| Molecular Formula | C29H26N2O6 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | [2-amino-3-cyano-4-(4-methoxycarbonylphenyl)-4H-chromen-7-yl] 2-butoxybenzoate |
| SMILES | CCCCOc1ccccc1C(=O)Oc1ccc2c(c1)OC(N)=C(C#N)C2c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C29H26N2O6/c1-3-4-15-35-24-8-6-5-7-22(24)29(33)36-20-13-14-21-25(16-20)37-27(31)23(17-30)26(21)18-9-11-19(12-10-18)28(32)34-2/h5-14,16,26H,3-4,15,31H2,1-2H3 |
| InChIKey | ARMRQVPJHWRQTI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 120.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|