C32H26N2O5 — CID 19123649
[2-amino-3-cyano-4-(3-phenoxyphenyl)-4H-chromen-7-yl] 2-propoxybenzoate (PubChem CID 19123649) has the molecular formula C32H26N2O5 and a molecular weight of 518.57 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-phenoxyphenyl)-4H-chromen-7-yl] 2-propoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-(3-phenoxyphenyl)-4H-chromen-7-yl] 2-propoxybenzoate |
|---|---|
| PubChem CID | 19123649 |
| Molecular Formula | C32H26N2O5 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | [2-amino-3-cyano-4-(3-phenoxyphenyl)-4H-chromen-7-yl] 2-propoxybenzoate |
| SMILES | CCCOc1ccccc1C(=O)Oc1ccc2c(c1)OC(N)=C(C#N)C2c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C32H26N2O5/c1-2-17-36-28-14-7-6-13-26(28)32(35)38-24-15-16-25-29(19-24)39-31(34)27(20-33)30(25)21-9-8-12-23(18-21)37-22-10-4-3-5-11-22/h3-16,18-19,30H,2,17,34H2,1H3 |
| InChIKey | OLYYNACMJWEFBN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|