C31H32N2O4 — CID 19120855
[2-amino-4-(4-tert-butylphenyl)-3-cyano-4H-chromen-7-yl] 2-butoxybenzoate (PubChem CID 19120855) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is [2-amino-4-(4-tert-butylphenyl)-3-cyano-4H-chromen-7-yl] 2-butoxybenzoate.
| Compound Name | [2-amino-4-(4-tert-butylphenyl)-3-cyano-4H-chromen-7-yl] 2-butoxybenzoate |
|---|---|
| PubChem CID | 19120855 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | [2-amino-4-(4-tert-butylphenyl)-3-cyano-4H-chromen-7-yl] 2-butoxybenzoate |
| SMILES | CCCCOc1ccccc1C(=O)Oc1ccc2c(c1)OC(N)=C(C#N)C2c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H32N2O4/c1-5-6-17-35-26-10-8-7-9-24(26)30(34)36-22-15-16-23-27(18-22)37-29(33)25(19-32)28(23)20-11-13-21(14-12-20)31(2,3)4/h7-16,18,28H,5-6,17,33H2,1-4H3 |
| InChIKey | LQXLYSRGGRECJY-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|