C33H36N2O6 — CID 19123330
[2-amino-3-cyano-4-(3-methoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 2-butoxybenzoate (PubChem CID 19123330) has the molecular formula C33H36N2O6 and a molecular weight of 556.66 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-methoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 2-butoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-(3-methoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 2-butoxybenzoate |
|---|---|
| PubChem CID | 19123330 |
| Molecular Formula | C33H36N2O6 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | [2-amino-3-cyano-4-(3-methoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 2-butoxybenzoate |
| SMILES | CCCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccccc4OCCCC)ccc32)cc1OC |
| InChI | InChI=1S/C33H36N2O6/c1-4-6-10-18-39-28-16-13-22(19-30(28)37-3)31-24-15-14-23(20-29(24)41-32(35)26(31)21-34)40-33(36)25-11-8-9-12-27(25)38-17-7-5-2/h8-9,11-16,19-20,31H,4-7,10,17-18,35H2,1-3H3 |
| InChIKey | INTWBADIDMMMJK-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|