C31H31FN2O6 — CID 19123307
[2-amino-3-cyano-4-(3-methoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 2-(4-fluorophenoxy)propanoate (PubChem CID 19123307) has the molecular formula C31H31FN2O6 and a molecular weight of 546.60 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-methoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 2-(4-fluorophenoxy)propanoate.
| Compound Name | [2-amino-3-cyano-4-(3-methoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 2-(4-fluorophenoxy)propanoate |
|---|---|
| PubChem CID | 19123307 |
| Molecular Formula | C31H31FN2O6 |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | [2-amino-3-cyano-4-(3-methoxy-4-pentoxyphenyl)-4H-chromen-7-yl] 2-(4-fluorophenoxy)propanoate |
| SMILES | CCCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)C(C)Oc4ccc(F)cc4)ccc32)cc1OC |
| InChI | InChI=1S/C31H31FN2O6/c1-4-5-6-15-37-26-14-7-20(16-28(26)36-3)29-24-13-12-23(17-27(24)40-30(34)25(29)18-33)39-31(35)19(2)38-22-10-8-21(32)9-11-22/h7-14,16-17,19,29H,4-6,15,34H2,1-3H3 |
| InChIKey | CNDJASDTNPWOBN-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|