C32H34N2O5 — CID 19125643
[2-amino-3-cyano-4-(4-pentoxyphenyl)-4H-chromen-7-yl] 2-(4-ethylphenoxy)propanoate (PubChem CID 19125643) has the molecular formula C32H34N2O5 and a molecular weight of 526.63 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-pentoxyphenyl)-4H-chromen-7-yl] 2-(4-ethylphenoxy)propanoate.
| Compound Name | [2-amino-3-cyano-4-(4-pentoxyphenyl)-4H-chromen-7-yl] 2-(4-ethylphenoxy)propanoate |
|---|---|
| PubChem CID | 19125643 |
| Molecular Formula | C32H34N2O5 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | [2-amino-3-cyano-4-(4-pentoxyphenyl)-4H-chromen-7-yl] 2-(4-ethylphenoxy)propanoate |
| SMILES | CCCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)C(C)Oc4ccc(CC)cc4)ccc32)cc1 |
| InChI | InChI=1S/C32H34N2O5/c1-4-6-7-18-36-24-14-10-23(11-15-24)30-27-17-16-26(19-29(27)39-31(34)28(30)20-33)38-32(35)21(3)37-25-12-8-22(5-2)9-13-25/h8-17,19,21,30H,4-7,18,34H2,1-3H3 |
| InChIKey | QTNXZVALBHXNBK-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|