C34H36Cl2N2O5 — CID 19129456
[2-amino-3-cyano-4-(4-heptoxyphenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate (PubChem CID 19129456) has the molecular formula C34H36Cl2N2O5 and a molecular weight of 623.58 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-heptoxyphenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate.
| Compound Name | [2-amino-3-cyano-4-(4-heptoxyphenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 19129456 |
| Molecular Formula | C34H36Cl2N2O5 |
| Molecular Weight | 623.58 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | [2-amino-3-cyano-4-(4-heptoxyphenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate |
| SMILES | CCCCCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cc(Cl)c(OCCCC)c(Cl)c4)ccc32)cc1 |
| InChI | InChI=1S/C34H36Cl2N2O5/c1-3-5-7-8-9-17-40-24-12-10-22(11-13-24)31-26-15-14-25(20-30(26)43-33(38)27(31)21-37)42-34(39)23-18-28(35)32(29(36)19-23)41-16-6-4-2/h10-15,18-20,31H,3-9,16-17,38H2,1-2H3 |
| InChIKey | NHLQQBUYTSXZCX-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.58 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|