C26H19BrCl2N2O4 — CID 19128231
[2-amino-4-(3-bromophenyl)-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate (PubChem CID 19128231) has the molecular formula C26H19BrCl2N2O4 and a molecular weight of 574.26 g/mol. Its IUPAC name is [2-amino-4-(3-bromophenyl)-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate.
| Compound Name | [2-amino-4-(3-bromophenyl)-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate |
|---|---|
| PubChem CID | 19128231 |
| Molecular Formula | C26H19BrCl2N2O4 |
| Molecular Weight | 574.26 g/mol |
| Exact Mass | 571.99 |
| IUPAC Name | [2-amino-4-(3-bromophenyl)-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate |
| SMILES | CCCOc1c(Cl)cc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2cccc(Br)c2)cc1Cl |
| InChI | InChI=1S/C26H19BrCl2N2O4/c1-2-8-33-24-20(28)10-15(11-21(24)29)26(32)34-17-6-7-18-22(12-17)35-25(31)19(13-30)23(18)14-4-3-5-16(27)9-14/h3-7,9-12,23H,2,8,31H2,1H3 |
| InChIKey | APLUYJZEFZPXOC-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.26 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|