C26H21BrN2O4 — CID 19125110
[2-amino-3-cyano-4-(3-propoxyphenyl)-4H-chromen-7-yl] 4-bromobenzoate (PubChem CID 19125110) has the molecular formula C26H21BrN2O4 and a molecular weight of 505.37 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-propoxyphenyl)-4H-chromen-7-yl] 4-bromobenzoate.
| Compound Name | [2-amino-3-cyano-4-(3-propoxyphenyl)-4H-chromen-7-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 19125110 |
| Molecular Formula | C26H21BrN2O4 |
| Molecular Weight | 505.37 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | [2-amino-3-cyano-4-(3-propoxyphenyl)-4H-chromen-7-yl] 4-bromobenzoate |
| SMILES | CCCOc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccc(Br)cc4)ccc32)c1 |
| InChI | InChI=1S/C26H21BrN2O4/c1-2-12-31-19-5-3-4-17(13-19)24-21-11-10-20(14-23(21)33-25(29)22(24)15-28)32-26(30)16-6-8-18(27)9-7-16/h3-11,13-14,24H,2,12,29H2,1H3 |
| InChIKey | OIJKWIVMCJPXAL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.37 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|