C29H28N2O5 — CID 19121226
[2-amino-3-cyano-4-(4-propoxyphenyl)-4H-chromen-7-yl] 4-propoxybenzoate (PubChem CID 19121226) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-propoxyphenyl)-4H-chromen-7-yl] 4-propoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-(4-propoxyphenyl)-4H-chromen-7-yl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 19121226 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | [2-amino-3-cyano-4-(4-propoxyphenyl)-4H-chromen-7-yl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCCC)cc2)cc1 |
| InChI | InChI=1S/C29H28N2O5/c1-3-15-33-21-9-5-19(6-10-21)27-24-14-13-23(17-26(24)36-28(31)25(27)18-30)35-29(32)20-7-11-22(12-8-20)34-16-4-2/h5-14,17,27H,3-4,15-16,31H2,1-2H3 |
| InChIKey | BLQRLEVQGIXCKO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|