C28H25BrN2O4 — CID 19125350
[2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 4-bromobenzoate (PubChem CID 19125350) has the molecular formula C28H25BrN2O4 and a molecular weight of 533.42 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 4-bromobenzoate.
| Compound Name | [2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 19125350 |
| Molecular Formula | C28H25BrN2O4 |
| Molecular Weight | 533.42 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | [2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 4-bromobenzoate |
| SMILES | CCCCCOc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccc(Br)cc4)ccc32)c1 |
| InChI | InChI=1S/C28H25BrN2O4/c1-2-3-4-14-33-21-7-5-6-19(15-21)26-23-13-12-22(16-25(23)35-27(31)24(26)17-30)34-28(32)18-8-10-20(29)11-9-18/h5-13,15-16,26H,2-4,14,31H2,1H3 |
| InChIKey | NXJSIYWSBBPMGE-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.42 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|