C29H26Cl2N2O5 — CID 19125549
[2-amino-4-(3-butoxyphenyl)-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate (PubChem CID 19125549) has the molecular formula C29H26Cl2N2O5 and a molecular weight of 553.44 g/mol. Its IUPAC name is [2-amino-4-(3-butoxyphenyl)-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate.
| Compound Name | [2-amino-4-(3-butoxyphenyl)-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate |
|---|---|
| PubChem CID | 19125549 |
| Molecular Formula | C29H26Cl2N2O5 |
| Molecular Weight | 553.44 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | [2-amino-4-(3-butoxyphenyl)-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate |
| SMILES | CCCCOc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cc(Cl)c(OCC)c(Cl)c4)ccc32)c1 |
| InChI | InChI=1S/C29H26Cl2N2O5/c1-3-5-11-36-19-8-6-7-17(12-19)26-21-10-9-20(15-25(21)38-28(33)22(26)16-32)37-29(34)18-13-23(30)27(35-4-2)24(31)14-18/h6-10,12-15,26H,3-5,11,33H2,1-2H3 |
| InChIKey | SXSUBEZMJWOHCZ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.44 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|