C33H24Cl4N2O5 — CID 19129791
[2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate (PubChem CID 19129791) has the molecular formula C33H24Cl4N2O5 and a molecular weight of 670.38 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate |
|---|---|
| PubChem CID | 19129791 |
| Molecular Formula | C33H24Cl4N2O5 |
| Molecular Weight | 670.38 g/mol |
| Exact Mass | 668.04 |
| IUPAC Name | [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate |
| SMILES | CCCOc1c(Cl)cc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2cccc(OCc3ccc(Cl)cc3Cl)c2)cc1Cl |
| InChI | InChI=1S/C33H24Cl4N2O5/c1-2-10-41-31-27(36)12-20(13-28(31)37)33(40)43-23-8-9-24-29(15-23)44-32(39)25(16-38)30(24)18-4-3-5-22(11-18)42-17-19-6-7-21(34)14-26(19)35/h3-9,11-15,30H,2,10,17,39H2,1H3 |
| InChIKey | XSHPPURHIMKYFJ-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.38 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|