C32H23Cl3N2O5 — CID 19126667
[2-amino-4-[3-[(4-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate (PubChem CID 19126667) has the molecular formula C32H23Cl3N2O5 and a molecular weight of 621.90 g/mol. Its IUPAC name is [2-amino-4-[3-[(4-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate.
| Compound Name | [2-amino-4-[3-[(4-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate |
|---|---|
| PubChem CID | 19126667 |
| Molecular Formula | C32H23Cl3N2O5 |
| Molecular Weight | 621.90 g/mol |
| Exact Mass | 620.07 |
| IUPAC Name | [2-amino-4-[3-[(4-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate |
| SMILES | CCOc1c(Cl)cc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2cccc(OCc3ccc(Cl)cc3)c2)cc1Cl |
| InChI | InChI=1S/C32H23Cl3N2O5/c1-2-39-30-26(34)13-20(14-27(30)35)32(38)41-23-10-11-24-28(15-23)42-31(37)25(16-36)29(24)19-4-3-5-22(12-19)40-17-18-6-8-21(33)9-7-18/h3-15,29H,2,17,37H2,1H3 |
| InChIKey | ZFCSCQXTTVLDIA-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.90 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|