C25H17Cl2N3O6 — CID 19122112
[2-amino-3-cyano-4-(4-nitrophenyl)-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate (PubChem CID 19122112) has the molecular formula C25H17Cl2N3O6 and a molecular weight of 526.33 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-nitrophenyl)-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-(4-nitrophenyl)-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate |
|---|---|
| PubChem CID | 19122112 |
| Molecular Formula | C25H17Cl2N3O6 |
| Molecular Weight | 526.33 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | [2-amino-3-cyano-4-(4-nitrophenyl)-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate |
| SMILES | CCOc1c(Cl)cc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc([N+](=O)[O-])cc2)cc1Cl |
| InChI | InChI=1S/C25H17Cl2N3O6/c1-2-34-23-19(26)9-14(10-20(23)27)25(31)35-16-7-8-17-21(11-16)36-24(29)18(12-28)22(17)13-3-5-15(6-4-13)30(32)33/h3-11,22H,2,29H2,1H3 |
| InChIKey | HGRPUIFPCOSXFQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.33 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|