C28H24Cl2N2O5 — CID 19128063
[2-amino-3-cyano-4-(2-ethoxyphenyl)-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate (PubChem CID 19128063) has the molecular formula C28H24Cl2N2O5 and a molecular weight of 539.42 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2-ethoxyphenyl)-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-(2-ethoxyphenyl)-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate |
|---|---|
| PubChem CID | 19128063 |
| Molecular Formula | C28H24Cl2N2O5 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | [2-amino-3-cyano-4-(2-ethoxyphenyl)-4H-chromen-7-yl] 3,5-dichloro-4-propoxybenzoate |
| SMILES | CCCOc1c(Cl)cc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccccc2OCC)cc1Cl |
| InChI | InChI=1S/C28H24Cl2N2O5/c1-3-11-35-26-21(29)12-16(13-22(26)30)28(33)36-17-9-10-19-24(14-17)37-27(32)20(15-31)25(19)18-7-5-6-8-23(18)34-4-2/h5-10,12-14,25H,3-4,11,32H2,1-2H3 |
| InChIKey | HGYKJYVYCQEYMI-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|